4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid

C14H13F2NO2S — CID 106006335

IUPAC4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid
SMILESCCc1ccc(CNc2ccc(C(=O)O)c(F)c2F)s1
InChIInChI=1S/C14H13F2NO2S/c1-2-8-3-4-9(20-8)7-17-11-6-5-10(14(18)19)12(15)13(11)16/h3-6,17H,2,7H2,1H3,(H,18,19)
InChIKeyRLPDTAFBSQGHQL-UHFFFAOYSA-N
MW297.33 g/mol
LogP3.90
Rot. Bonds5

About 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid

4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid (PubChem CID 106006335) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid.

Molecular Properties

Compound Name4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid
PubChem CID106006335
Molecular FormulaC14H13F2NO2S
Molecular Weight297.33 g/mol
Exact Mass297.06
IUPAC Name4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid
SMILESCCc1ccc(CNc2ccc(C(=O)O)c(F)c2F)s1
InChIInChI=1S/C14H13F2NO2S/c1-2-8-3-4-9(20-8)7-17-11-6-5-10(14(18)19)12(15)13(11)16/h3-6,17H,2,7H2,1H3,(H,18,19)
InChIKeyRLPDTAFBSQGHQL-UHFFFAOYSA-N
XLogP3.90
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.33
LogP ≤ 53.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid?
The IUPAC name of 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid (CID 106006335) is 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid.
What is the SMILES notation for 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid?
The canonical SMILES for 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid is CCc1ccc(CNc2ccc(C(=O)O)c(F)c2F)s1.
What is the InChIKey of 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid?
The InChIKey is RLPDTAFBSQGHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2S/c1-2-8-3-4-9(20-8)7-17-11-6-5-10(14(18)19)12(15)13(11)16/h3-6,17H,2,7H2,1H3,(H,18,19).
What are the key properties of 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid?
4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid has a molecular weight of 297.33 g/mol, XLogP of 3.90, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-ethylthiophen-2-yl)methylamino]-2,3-difluorobenzoic acid is sourced from PubChem (CID 106006335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).