C11H8F2N2O3 — CID 106419123
2,3-difluoro-4-(1,2-oxazol-5-ylmethylamino)benzoic acid (PubChem CID 106419123) has the molecular formula C11H8F2N2O3 and a molecular weight of 254.19 g/mol. Its IUPAC name is 2,3-difluoro-4-(1,2-oxazol-5-ylmethylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(1,2-oxazol-5-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 106419123 |
| Molecular Formula | C11H8F2N2O3 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2,3-difluoro-4-(1,2-oxazol-5-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccno2)c(F)c1F |
| InChI | InChI=1S/C11H8F2N2O3/c12-9-7(11(16)17)1-2-8(10(9)13)14-5-6-3-4-15-18-6/h1-4,14H,5H2,(H,16,17) |
| InChIKey | ICPHFLCFXKWFAZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |