C15H14F2N2O2 — CID 81093298
4-[[4-(aminomethyl)phenyl]methylamino]-2,3-difluorobenzoic acid (PubChem CID 81093298) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)phenyl]methylamino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[[4-(aminomethyl)phenyl]methylamino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 81093298 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[[4-(aminomethyl)phenyl]methylamino]-2,3-difluorobenzoic acid |
| SMILES | NCc1ccc(CNc2ccc(C(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H14F2N2O2/c16-13-11(15(20)21)5-6-12(14(13)17)19-8-10-3-1-9(7-18)2-4-10/h1-6,19H,7-8,18H2,(H,20,21) |
| InChIKey | FIOLHKWPFMTAAO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |