C11H9F2N3O2 — CID 79840872
2,3-difluoro-4-(1H-imidazol-5-ylmethylamino)benzoic acid (PubChem CID 79840872) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is 2,3-difluoro-4-(1H-imidazol-5-ylmethylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(1H-imidazol-5-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 79840872 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2,3-difluoro-4-(1H-imidazol-5-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2cnc[nH]2)c(F)c1F |
| InChI | InChI=1S/C11H9F2N3O2/c12-9-7(11(17)18)1-2-8(10(9)13)15-4-6-3-14-5-16-6/h1-3,5,15H,4H2,(H,14,16)(H,17,18) |
| InChIKey | BJEYIUVUTOTUCY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |