C14H12F2N2O2 — CID 79838578
2,3-difluoro-4-[(6-methyl-2-pyridinyl)methylamino]benzoic acid (PubChem CID 79838578) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2,3-difluoro-4-[(6-methyl-2-pyridinyl)methylamino]benzoic acid.
| Compound Name | 2,3-difluoro-4-[(6-methyl-2-pyridinyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 79838578 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2,3-difluoro-4-[(6-methyl-2-pyridinyl)methylamino]benzoic acid |
| SMILES | Cc1cccc(CNc2ccc(C(=O)O)c(F)c2F)n1 |
| InChI | InChI=1S/C14H12F2N2O2/c1-8-3-2-4-9(18-8)7-17-11-6-5-10(14(19)20)12(15)13(11)16/h2-6,17H,7H2,1H3,(H,19,20) |
| InChIKey | HOFUADYSHQCQFE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |