C12H9F2NO3 — CID 79837782
2,3-difluoro-4-(furan-2-ylmethylamino)benzoic acid (PubChem CID 79837782) has the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. Its IUPAC name is 2,3-difluoro-4-(furan-2-ylmethylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(furan-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 79837782 |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2,3-difluoro-4-(furan-2-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccco2)c(F)c1F |
| InChI | InChI=1S/C12H9F2NO3/c13-10-8(12(16)17)3-4-9(11(10)14)15-6-7-2-1-5-18-7/h1-5,15H,6H2,(H,16,17) |
| InChIKey | XUSHSEKOQODXMP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |