C16H11F3N4O2 — CID 109279633
5-(furan-2-ylmethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide (PubChem CID 109279633) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is 5-(furan-2-ylmethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(furan-2-ylmethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109279633 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-(furan-2-ylmethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cnc(NCc2ccco2)cn1 |
| InChI | InChI=1S/C16H11F3N4O2/c17-10-3-4-11(15(19)14(10)18)23-16(24)12-7-22-13(8-20-12)21-6-9-2-1-5-25-9/h1-5,7-8H,6H2,(H,21,22)(H,23,24) |
| InChIKey | HYJNOIQETRYRKT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|