C14H13F3N4O2 — CID 109276018
5-(2-methoxyethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide (PubChem CID 109276018) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 5-(2-methoxyethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(2-methoxyethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109276018 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 5-(2-methoxyethylamino)-N-(2,3,4-trifluorophenyl)pyrazine-2-carboxamide |
| SMILES | COCCNc1cnc(C(=O)Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C14H13F3N4O2/c1-23-5-4-18-11-7-19-10(6-20-11)14(22)21-9-3-2-8(15)12(16)13(9)17/h2-3,6-7H,4-5H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | SRJMSHXYYDOMAG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|