C18H16N4O4 — CID 109279589
methyl 3-[[5-(furan-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate (PubChem CID 109279589) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is methyl 3-[[5-(furan-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[5-(furan-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109279589 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 3-[[5-(furan-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cnc(NCc3ccco3)cn2)c1 |
| InChI | InChI=1S/C18H16N4O4/c1-25-18(24)12-4-2-5-13(8-12)22-17(23)15-10-21-16(11-19-15)20-9-14-6-3-7-26-14/h2-8,10-11H,9H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | DMSKIWMPJRDMGH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |