C13H11F2NO3 — CID 79838073
2,3-difluoro-4-[1-(furan-2-yl)ethylamino]benzoic acid (PubChem CID 79838073) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is 2,3-difluoro-4-[1-(furan-2-yl)ethylamino]benzoic acid.
| Compound Name | 2,3-difluoro-4-[1-(furan-2-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 79838073 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2,3-difluoro-4-[1-(furan-2-yl)ethylamino]benzoic acid |
| SMILES | CC(Nc1ccc(C(=O)O)c(F)c1F)c1ccco1 |
| InChI | InChI=1S/C13H11F2NO3/c1-7(10-3-2-6-19-10)16-9-5-4-8(13(17)18)11(14)12(9)15/h2-7,16H,1H3,(H,17,18) |
| InChIKey | STRGRIGWTPQGOJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |