C11H12F2N2O3 — CID 114189738
2,3-difluoro-4-[(3-hydroxyazetidin-3-yl)methylamino]benzoic acid (PubChem CID 114189738) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is 2,3-difluoro-4-[(3-hydroxyazetidin-3-yl)methylamino]benzoic acid.
| Compound Name | 2,3-difluoro-4-[(3-hydroxyazetidin-3-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 114189738 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2,3-difluoro-4-[(3-hydroxyazetidin-3-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCC2(O)CNC2)c(F)c1F |
| InChI | InChI=1S/C11H12F2N2O3/c12-8-6(10(16)17)1-2-7(9(8)13)15-5-11(18)3-14-4-11/h1-2,14-15,18H,3-5H2,(H,16,17) |
| InChIKey | RPVVCQNXASYQRH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |