C15H15F2NO2S — CID 61335529
5-[1-(5-ethylthiophen-2-yl)ethylamino]-2,4-difluorobenzoic acid (PubChem CID 61335529) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is 5-[1-(5-ethylthiophen-2-yl)ethylamino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[1-(5-ethylthiophen-2-yl)ethylamino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 61335529 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-[1-(5-ethylthiophen-2-yl)ethylamino]-2,4-difluorobenzoic acid |
| SMILES | CCc1ccc(C(C)Nc2cc(C(=O)O)c(F)cc2F)s1 |
| InChI | InChI=1S/C15H15F2NO2S/c1-3-9-4-5-14(21-9)8(2)18-13-6-10(15(19)20)11(16)7-12(13)17/h4-8,18H,3H2,1-2H3,(H,19,20) |
| InChIKey | HFQKOEXHZNRBEM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |