C15H17NO2S — CID 61333563
4-[1-(5-ethylthiophen-2-yl)ethylamino]benzoic acid (PubChem CID 61333563) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 4-[1-(5-ethylthiophen-2-yl)ethylamino]benzoic acid.
| Compound Name | 4-[1-(5-ethylthiophen-2-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 61333563 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-[1-(5-ethylthiophen-2-yl)ethylamino]benzoic acid |
| SMILES | CCc1ccc(C(C)Nc2ccc(C(=O)O)cc2)s1 |
| InChI | InChI=1S/C15H17NO2S/c1-3-13-8-9-14(19-13)10(2)16-12-6-4-11(5-7-12)15(17)18/h4-10,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | GTXQMRHIEOJLNY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |