C17H22N2OS — CID 61335120
4-[1-(5-ethylthiophen-2-yl)ethylamino]-N,N-dimethylbenzamide (PubChem CID 61335120) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-[1-(5-ethylthiophen-2-yl)ethylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[1-(5-ethylthiophen-2-yl)ethylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 61335120 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[1-(5-ethylthiophen-2-yl)ethylamino]-N,N-dimethylbenzamide |
| SMILES | CCc1ccc(C(C)Nc2ccc(C(=O)N(C)C)cc2)s1 |
| InChI | InChI=1S/C17H22N2OS/c1-5-15-10-11-16(21-15)12(2)18-14-8-6-13(7-9-14)17(20)19(3)4/h6-12,18H,5H2,1-4H3 |
| InChIKey | YSFDBCCMDYEYDP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |