C14H13F2NO2S — CID 63993254
2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzoic acid (PubChem CID 63993254) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 63993254 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzoic acid |
| SMILES | Cc1ccsc1C(C)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C14H13F2NO2S/c1-7-3-4-20-13(7)8(2)17-12-5-9(14(18)19)10(15)6-11(12)16/h3-6,8,17H,1-2H3,(H,18,19) |
| InChIKey | ITMPCQFKBFAAAJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |