C14H14F2N2OS — CID 63990643
2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzamide (PubChem CID 63990643) has the molecular formula C14H14F2N2OS and a molecular weight of 296.34 g/mol. Its IUPAC name is 2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzamide.
| Compound Name | 2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 63990643 |
| Molecular Formula | C14H14F2N2OS |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,4-difluoro-5-[1-(3-methylthiophen-2-yl)ethylamino]benzamide |
| SMILES | Cc1ccsc1C(C)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C14H14F2N2OS/c1-7-3-4-20-13(7)8(2)18-12-5-9(14(17)19)10(15)6-11(12)16/h3-6,8,18H,1-2H3,(H2,17,19) |
| InChIKey | QHDUPSARPWFMAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |