C13H12F3NS — CID 63993191
2,3,4-trifluoro-N-[1-(3-methylthiophen-2-yl)ethyl]aniline (PubChem CID 63993191) has the molecular formula C13H12F3NS and a molecular weight of 271.31 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[1-(3-methylthiophen-2-yl)ethyl]aniline.
| Compound Name | 2,3,4-trifluoro-N-[1-(3-methylthiophen-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 63993191 |
| Molecular Formula | C13H12F3NS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[1-(3-methylthiophen-2-yl)ethyl]aniline |
| SMILES | Cc1ccsc1C(C)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H12F3NS/c1-7-5-6-18-13(7)8(2)17-10-4-3-9(14)11(15)12(10)16/h3-6,8,17H,1-2H3 |
| InChIKey | ZTICYTSNLJIWRH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|