2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid

C13H15F2NO2 — CID 43737134

IUPAC2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid
SMILESCC(Nc1cc(C(=O)O)c(F)cc1F)C1(C)CC1
InChIInChI=1S/C13H15F2NO2/c1-7(13(2)3-4-13)16-11-5-8(12(17)18)9(14)6-10(11)15/h5-7,16H,3-4H2,1-2H3,(H,17,18)
InChIKeyYBVBVNYIWDYBDQ-UHFFFAOYSA-N
MW255.26 g/mol
LogP3.26
Rot. Bonds4

About 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid

2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid (PubChem CID 43737134) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid.

Molecular Properties

Compound Name2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid
PubChem CID43737134
Molecular FormulaC13H15F2NO2
Molecular Weight255.26 g/mol
Exact Mass255.11
IUPAC Name2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid
SMILESCC(Nc1cc(C(=O)O)c(F)cc1F)C1(C)CC1
InChIInChI=1S/C13H15F2NO2/c1-7(13(2)3-4-13)16-11-5-8(12(17)18)9(14)6-10(11)15/h5-7,16H,3-4H2,1-2H3,(H,17,18)
InChIKeyYBVBVNYIWDYBDQ-UHFFFAOYSA-N
XLogP3.26
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.26
LogP ≤ 53.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid?
The IUPAC name of 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid (CID 43737134) is 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid.
What is the SMILES notation for 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid?
The canonical SMILES for 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid is CC(Nc1cc(C(=O)O)c(F)cc1F)C1(C)CC1.
What is the InChIKey of 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid?
The InChIKey is YBVBVNYIWDYBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c1-7(13(2)3-4-13)16-11-5-8(12(17)18)9(14)6-10(11)15/h5-7,16H,3-4H2,1-2H3,(H,17,18).
What are the key properties of 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid?
2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid has a molecular weight of 255.26 g/mol, XLogP of 3.26, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-5-[1-(1-methylcyclopropyl)ethylamino]benzoic acid is sourced from PubChem (CID 43737134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).