C14H14Cl2FNS — CID 107572802
3,5-dichloro-N-[1-(5-ethylthiophen-2-yl)ethyl]-4-fluoroaniline (PubChem CID 107572802) has the molecular formula C14H14Cl2FNS and a molecular weight of 318.24 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-(5-ethylthiophen-2-yl)ethyl]-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-[1-(5-ethylthiophen-2-yl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 107572802 |
| Molecular Formula | C14H14Cl2FNS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 3,5-dichloro-N-[1-(5-ethylthiophen-2-yl)ethyl]-4-fluoroaniline |
| SMILES | CCc1ccc(C(C)Nc2cc(Cl)c(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C14H14Cl2FNS/c1-3-10-4-5-13(19-10)8(2)18-9-6-11(15)14(17)12(16)7-9/h4-8,18H,3H2,1-2H3 |
| InChIKey | NPXAXUFVJZBZPH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|