C15H13F2NO3 — CID 43737081
2,4-difluoro-5-[(2-methoxyphenyl)methylamino]benzoic acid (PubChem CID 43737081) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 2,4-difluoro-5-[(2-methoxyphenyl)methylamino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[(2-methoxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 43737081 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2,4-difluoro-5-[(2-methoxyphenyl)methylamino]benzoic acid |
| SMILES | COc1ccccc1CNc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C15H13F2NO3/c1-21-14-5-3-2-4-9(14)8-18-13-6-10(15(19)20)11(16)7-12(13)17/h2-7,18H,8H2,1H3,(H,19,20) |
| InChIKey | OPMFDHYBFBSVJJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |