C12H6BrF2NO3S — CID 102854653
5-[(5-bromo-2,4-difluorophenyl)carbamoyl]thiophene-2-carboxylic acid (PubChem CID 102854653) has the molecular formula C12H6BrF2NO3S and a molecular weight of 362.15 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-difluorophenyl)carbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(5-bromo-2,4-difluorophenyl)carbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102854653 |
| Molecular Formula | C12H6BrF2NO3S |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 360.92 |
| IUPAC Name | 5-[(5-bromo-2,4-difluorophenyl)carbamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)Nc2cc(Br)c(F)cc2F)s1 |
| InChI | InChI=1S/C12H6BrF2NO3S/c13-5-3-8(7(15)4-6(5)14)16-11(17)9-1-2-10(20-9)12(18)19/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | ZHERITHJBONEQI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|