C12H7BrF2N2S — CID 102853084
5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carbonitrile (PubChem CID 102853084) has the molecular formula C12H7BrF2N2S and a molecular weight of 329.17 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 102853084 |
| Molecular Formula | C12H7BrF2N2S |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(CNc2cc(Br)c(F)cc2F)s1 |
| InChI | InChI=1S/C12H7BrF2N2S/c13-9-3-12(11(15)4-10(9)14)17-6-8-2-1-7(5-16)18-8/h1-4,17H,6H2 |
| InChIKey | DYJMGKYWNKLNBH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|