C14H14N2O2S — CID 115675634
5-[(2,4-dimethoxyanilino)methyl]thiophene-2-carbonitrile (PubChem CID 115675634) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyanilino)methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[(2,4-dimethoxyanilino)methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 115675634 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-[(2,4-dimethoxyanilino)methyl]thiophene-2-carbonitrile |
| SMILES | COc1ccc(NCc2ccc(C#N)s2)c(OC)c1 |
| InChI | InChI=1S/C14H14N2O2S/c1-17-10-3-6-13(14(7-10)18-2)16-9-12-5-4-11(8-15)19-12/h3-7,16H,9H2,1-2H3 |
| InChIKey | ILSHYQZMCQDPSU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|