C13H12N2O4S2 — CID 106266909
5-cyano-N-(2,4-dimethoxyphenyl)thiophene-2-sulfonamide (PubChem CID 106266909) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-cyano-N-(2,4-dimethoxyphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(2,4-dimethoxyphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106266909 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-cyano-N-(2,4-dimethoxyphenyl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C#N)s2)c(OC)c1 |
| InChI | InChI=1S/C13H12N2O4S2/c1-18-9-3-5-11(12(7-9)19-2)15-21(16,17)13-6-4-10(8-14)20-13/h3-7,15H,1-2H3 |
| InChIKey | XJJKLOQZZJGMBV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |