C22H25NO3 — CID 8750080
6-ethyl-7-hydroxy-4-[[[(2R)-2-phenylbutyl]amino]methyl]chromen-2-one (PubChem CID 8750080) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-4-[[[(2R)-2-phenylbutyl]amino]methyl]chromen-2-one.
| Compound Name | 6-ethyl-7-hydroxy-4-[[[(2R)-2-phenylbutyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 8750080 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 6-ethyl-7-hydroxy-4-[[[(2R)-2-phenylbutyl]amino]methyl]chromen-2-one |
| SMILES | CCc1cc2c(CNC[C@H](CC)c3ccccc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C22H25NO3/c1-3-15-10-19-18(11-22(25)26-21(19)12-20(15)24)14-23-13-16(4-2)17-8-6-5-7-9-17/h5-12,16,23-24H,3-4,13-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | CQPXSCKXUBMQJY-INIZCTEOSA-N |
| XLogP | 4.34 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|