C17H23NO3 — CID 8744144
6-ethyl-7-hydroxy-4-[[[(2R)-3-methylbutan-2-yl]amino]methyl]chromen-2-one (PubChem CID 8744144) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-4-[[[(2R)-3-methylbutan-2-yl]amino]methyl]chromen-2-one.
| Compound Name | 6-ethyl-7-hydroxy-4-[[[(2R)-3-methylbutan-2-yl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 8744144 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-ethyl-7-hydroxy-4-[[[(2R)-3-methylbutan-2-yl]amino]methyl]chromen-2-one |
| SMILES | CCc1cc2c(CN[C@H](C)C(C)C)cc(=O)oc2cc1O |
| InChI | InChI=1S/C17H23NO3/c1-5-12-6-14-13(9-18-11(4)10(2)3)7-17(20)21-16(14)8-15(12)19/h6-8,10-11,18-19H,5,9H2,1-4H3/t11-/m1/s1 |
| InChIKey | JEIIDCVRWDKAMS-LLVKDONJSA-N |
| XLogP | 3.20 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|