C18H24NO4+ — CID 9265667
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(4-hydroxycyclohexyl)azanium (PubChem CID 9265667) has the molecular formula C18H24NO4+ and a molecular weight of 318.39 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(4-hydroxycyclohexyl)azanium.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(4-hydroxycyclohexyl)azanium |
|---|---|
| PubChem CID | 9265667 |
| Molecular Formula | C18H24NO4+ |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-(4-hydroxycyclohexyl)azanium |
| SMILES | CCc1cc2c(C[NH2+]C3CCC(O)CC3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C18H23NO4/c1-2-11-7-15-12(8-18(22)23-17(15)9-16(11)21)10-19-13-3-5-14(20)6-4-13/h7-9,13-14,19-21H,2-6,10H2,1H3/p+1 |
| InChIKey | XTRTWHCKEIVQJE-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|