C19H27N2O4+ — CID 8767492
[2-(tert-butylamino)-2-oxoethyl]-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 8767492) has the molecular formula C19H27N2O4+ and a molecular weight of 347.44 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8767492 |
| Molecular Formula | C19H27N2O4+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | CCc1cc2c(C[NH+](C)CC(=O)NC(C)(C)C)cc(=O)oc2cc1O |
| InChI | InChI=1S/C19H26N2O4/c1-6-12-7-14-13(8-18(24)25-16(14)9-15(12)22)10-21(5)11-17(23)20-19(2,3)4/h7-9,22H,6,10-11H2,1-5H3,(H,20,23)/p+1 |
| InChIKey | DQRCQNNMIJBQMD-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|