C21H24NO3+ — CID 8516750
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-methyl-[(2-methylphenyl)methyl]azanium (PubChem CID 8516750) has the molecular formula C21H24NO3+ and a molecular weight of 338.43 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-methyl-[(2-methylphenyl)methyl]azanium.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-methyl-[(2-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8516750 |
| Molecular Formula | C21H24NO3+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-methyl-[(2-methylphenyl)methyl]azanium |
| SMILES | CCc1cc2c(C[NH+](C)Cc3ccccc3C)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H23NO3/c1-4-15-9-18-17(10-21(24)25-20(18)11-19(15)23)13-22(3)12-16-8-6-5-7-14(16)2/h5-11,23H,4,12-13H2,1-3H3/p+1 |
| InChIKey | YLVBPCUALBSZAF-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|