C24H21NO3 — CID 44664741
4-[[benzyl(methyl)azaniumyl]methyl]-2-oxo-7-phenylchromen-6-olate (PubChem CID 44664741) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[[benzyl(methyl)azaniumyl]methyl]-2-oxo-7-phenylchromen-6-olate.
| Compound Name | 4-[[benzyl(methyl)azaniumyl]methyl]-2-oxo-7-phenylchromen-6-olate |
|---|---|
| PubChem CID | 44664741 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[[benzyl(methyl)azaniumyl]methyl]-2-oxo-7-phenylchromen-6-olate |
| SMILES | C[NH+](Cc1ccccc1)Cc1cc(=O)oc2cc(-c3ccccc3)c([O-])cc12 |
| InChI | InChI=1S/C24H21NO3/c1-25(15-17-8-4-2-5-9-17)16-19-12-24(27)28-23-14-20(22(26)13-21(19)23)18-10-6-3-7-11-18/h2-14,26H,15-16H2,1H3 |
| InChIKey | RDYXMKZHLUIDJB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|