C22H24NO4+ — CID 9337714
2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 9337714) has the molecular formula C22H24NO4+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9337714 |
| Molecular Formula | C22H24NO4+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | CCc1ccc2c(C[NH+](C)Cc3ccc4c(c3)OCCO4)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23NO4/c1-3-15-4-6-18-17(12-22(24)27-20(18)10-15)14-23(2)13-16-5-7-19-21(11-16)26-9-8-25-19/h4-7,10-12H,3,8-9,13-14H2,1-2H3/p+1 |
| InChIKey | FZGVDUVVOLLVOX-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|