C20H29N3O4S — CID 42102557
N,N-diethyl-4-[(7-ethyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide (PubChem CID 42102557) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is N,N-diethyl-4-[(7-ethyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-[(7-ethyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 42102557 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N,N-diethyl-4-[(7-ethyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide |
| SMILES | CCc1ccc2c(CN3CCN(S(=O)(=O)N(CC)CC)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-16-7-8-18-17(14-20(24)27-19(18)13-16)15-21-9-11-23(12-10-21)28(25,26)22(5-2)6-3/h7-8,13-14H,4-6,9-12,15H2,1-3H3 |
| InChIKey | CKJCATJQRXDKCO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|