C24H27FN2O3 — CID 9436274
7-ethyl-4-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]chromen-2-one (PubChem CID 9436274) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 7-ethyl-4-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9436274 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 7-ethyl-4-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]chromen-2-one |
| SMILES | CCc1ccc2c(CN3CCN(Cc4cc(F)ccc4OC)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H27FN2O3/c1-3-17-4-6-21-18(14-24(28)30-23(21)12-17)15-26-8-10-27(11-9-26)16-19-13-20(25)5-7-22(19)29-2/h4-7,12-14H,3,8-11,15-16H2,1-2H3 |
| InChIKey | GEWAJSOQSCTXQG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|