C21H22NO5+ — CID 9337737
2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 9337737) has the molecular formula C21H22NO5+ and a molecular weight of 368.41 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9337737 |
| Molecular Formula | C21H22NO5+ |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | Cc1c(O)ccc2c(C[NH+](C)Cc3ccc4c(c3)OCCO4)cc(=O)oc12 |
| InChI | InChI=1S/C21H21NO5/c1-13-17(23)5-4-16-15(10-20(24)27-21(13)16)12-22(2)11-14-3-6-18-19(9-14)26-8-7-25-18/h3-6,9-10,23H,7-8,11-12H2,1-2H3/p+1 |
| InChIKey | UETPYVRGDAAWMA-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|