C18H18NO6- — CID 7093583
1-[2-(7-hydroxy-8-methyl-2-oxochromen-4-yl)acetyl]piperidine-4-carboxylate (PubChem CID 7093583) has the molecular formula C18H18NO6- and a molecular weight of 344.34 g/mol. Its IUPAC name is 1-[2-(7-hydroxy-8-methyl-2-oxochromen-4-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | 1-[2-(7-hydroxy-8-methyl-2-oxochromen-4-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7093583 |
| Molecular Formula | C18H18NO6- |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[2-(7-hydroxy-8-methyl-2-oxochromen-4-yl)acetyl]piperidine-4-carboxylate |
| SMILES | Cc1c(O)ccc2c(CC(=O)N3CCC(C(=O)[O-])CC3)cc(=O)oc12 |
| InChI | InChI=1S/C18H19NO6/c1-10-14(20)3-2-13-12(9-16(22)25-17(10)13)8-15(21)19-6-4-11(5-7-19)18(23)24/h2-3,9,11,20H,4-8H2,1H3,(H,23,24)/p-1 |
| InChIKey | YMSKIMHQLFLCCB-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|