C18H24NO3+ — CID 9256644
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(1S,2R)-2-methylcyclohexyl]azanium (PubChem CID 9256644) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(1S,2R)-2-methylcyclohexyl]azanium.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(1S,2R)-2-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 9256644 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(1S,2R)-2-methylcyclohexyl]azanium |
| SMILES | Cc1c(O)ccc2c(C[NH2+][C@H]3CCCC[C@H]3C)cc(=O)oc12 |
| InChI | InChI=1S/C18H23NO3/c1-11-5-3-4-6-15(11)19-10-13-9-17(21)22-18-12(2)16(20)8-7-14(13)18/h7-9,11,15,19-20H,3-6,10H2,1-2H3/p+1/t11-,15+/m1/s1 |
| InChIKey | RVCHBWXVIAOULA-ABAIWWIYSA-O |
| XLogP | 2.45 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|