C20H21FNO3+ — CID 8744094
ethyl-[(3-fluorophenyl)methyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium (PubChem CID 8744094) has the molecular formula C20H21FNO3+ and a molecular weight of 342.39 g/mol. Its IUPAC name is ethyl-[(3-fluorophenyl)methyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | ethyl-[(3-fluorophenyl)methyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 8744094 |
| Molecular Formula | C20H21FNO3+ |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | ethyl-[(3-fluorophenyl)methyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium |
| SMILES | CC[NH+](Cc1cccc(F)c1)Cc1cc(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C20H20FNO3/c1-3-22(11-14-5-4-6-16(21)9-14)12-15-10-19(24)25-20-13(2)18(23)8-7-17(15)20/h4-10,23H,3,11-12H2,1-2H3/p+1 |
| InChIKey | BFCZOKVLLACRDW-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|