C22H25FNO4+ — CID 9349393
ethyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-[(3-fluoro-4-methoxyphenyl)methyl]azanium (PubChem CID 9349393) has the molecular formula C22H25FNO4+ and a molecular weight of 386.44 g/mol. Its IUPAC name is ethyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-[(3-fluoro-4-methoxyphenyl)methyl]azanium.
| Compound Name | ethyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-[(3-fluoro-4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9349393 |
| Molecular Formula | C22H25FNO4+ |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-[(3-fluoro-4-methoxyphenyl)methyl]azanium |
| SMILES | CCc1cc2c(C[NH+](CC)Cc3ccc(OC)c(F)c3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C22H24FNO4/c1-4-15-9-17-16(10-22(26)28-21(17)11-19(15)25)13-24(5-2)12-14-6-7-20(27-3)18(23)8-14/h6-11,25H,4-5,12-13H2,1-3H3/p+1 |
| InChIKey | QXACBASSVAOVPN-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|