C22H23FN2O4 — CID 18191566
N-[4-[[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]methyl]-2-oxochromen-7-yl]acetamide (PubChem CID 18191566) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[4-[[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]methyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]methyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 18191566 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[4-[[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]methyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CCN(Cc1ccc(OC)c(F)c1)Cc1cc(=O)oc2cc(NC(C)=O)ccc12 |
| InChI | InChI=1S/C22H23FN2O4/c1-4-25(12-15-5-8-20(28-3)19(23)9-15)13-16-10-22(27)29-21-11-17(24-14(2)26)6-7-18(16)21/h5-11H,4,12-13H2,1-3H3,(H,24,26) |
| InChIKey | UZZPRUHKTQTJAJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|