C18H23N3O4 — CID 87016917
2-[(7-acetamido-2-oxochromen-4-yl)methyl-butylamino]acetamide (PubChem CID 87016917) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[(7-acetamido-2-oxochromen-4-yl)methyl-butylamino]acetamide.
| Compound Name | 2-[(7-acetamido-2-oxochromen-4-yl)methyl-butylamino]acetamide |
|---|---|
| PubChem CID | 87016917 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[(7-acetamido-2-oxochromen-4-yl)methyl-butylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)Cc1cc(=O)oc2cc(NC(C)=O)ccc12 |
| InChI | InChI=1S/C18H23N3O4/c1-3-4-7-21(11-17(19)23)10-13-8-18(24)25-16-9-14(20-12(2)22)5-6-15(13)16/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H2,19,23)(H,20,22) |
| InChIKey | BYRNNISCJVWXQG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|