C17H22NO6P — CID 167213848
[7-(heptanoylamino)-2-oxochromen-4-yl]methylphosphonic acid (PubChem CID 167213848) has the molecular formula C17H22NO6P and a molecular weight of 367.34 g/mol. Its IUPAC name is [7-(heptanoylamino)-2-oxochromen-4-yl]methylphosphonic acid.
| Compound Name | [7-(heptanoylamino)-2-oxochromen-4-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 167213848 |
| Molecular Formula | C17H22NO6P |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [7-(heptanoylamino)-2-oxochromen-4-yl]methylphosphonic acid |
| SMILES | CCCCCCC(=O)Nc1ccc2c(CP(=O)(O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H22NO6P/c1-2-3-4-5-6-16(19)18-13-7-8-14-12(11-25(21,22)23)9-17(20)24-15(14)10-13/h7-10H,2-6,11H2,1H3,(H,18,19)(H2,21,22,23) |
| InChIKey | ALAHLNAKZWTUJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|