C13H16N2O6P+ — CID 167213382
trihydroxy-[[7-[[2-(methylamino)acetyl]amino]-2-oxochromen-4-yl]methyl]phosphanium (PubChem CID 167213382) has the molecular formula C13H16N2O6P+ and a molecular weight of 327.25 g/mol. Its IUPAC name is trihydroxy-[[7-[[2-(methylamino)acetyl]amino]-2-oxochromen-4-yl]methyl]phosphanium.
| Compound Name | trihydroxy-[[7-[[2-(methylamino)acetyl]amino]-2-oxochromen-4-yl]methyl]phosphanium |
|---|---|
| PubChem CID | 167213382 |
| Molecular Formula | C13H16N2O6P+ |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | trihydroxy-[[7-[[2-(methylamino)acetyl]amino]-2-oxochromen-4-yl]methyl]phosphanium |
| SMILES | CNCC(=O)Nc1ccc2c(C[P+](O)(O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C13H15N2O6P/c1-14-6-12(16)15-9-2-3-10-8(7-22(18,19)20)4-13(17)21-11(10)5-9/h2-5,14,18-20H,6-7H2,1H3/p+1 |
| InChIKey | RLFRNWXUMPZADJ-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|