C18H17N3O4S — CID 73353689
methyl N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-oxochromen-7-yl]carbamate (PubChem CID 73353689) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is methyl N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | methyl N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 73353689 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | methyl N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-oxochromen-7-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(CSc3nc(C)cc(C)n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H17N3O4S/c1-10-6-11(2)20-17(19-10)26-9-12-7-16(22)25-15-8-13(4-5-14(12)15)21-18(23)24-3/h4-8H,9H2,1-3H3,(H,21,23) |
| InChIKey | BCODSVHWNGHMGO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|