C15H16N2O4S2 — CID 118725378
methyl N-[4-(dimethylcarbamothioylsulfanylmethyl)-2-oxochromen-7-yl]carbamate (PubChem CID 118725378) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is methyl N-[4-(dimethylcarbamothioylsulfanylmethyl)-2-oxochromen-7-yl]carbamate.
| Compound Name | methyl N-[4-(dimethylcarbamothioylsulfanylmethyl)-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 118725378 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | methyl N-[4-(dimethylcarbamothioylsulfanylmethyl)-2-oxochromen-7-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(CSC(=S)N(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H16N2O4S2/c1-17(2)15(22)23-8-9-6-13(18)21-12-7-10(4-5-11(9)12)16-14(19)20-3/h4-7H,8H2,1-3H3,(H,16,19) |
| InChIKey | LOFQBPIYDYGYES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|