C19H15N3O6S — CID 7808588
ethyl N-[4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate (PubChem CID 7808588) has the molecular formula C19H15N3O6S and a molecular weight of 413.41 g/mol. Its IUPAC name is ethyl N-[4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 7808588 |
| Molecular Formula | C19H15N3O6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | ethyl N-[4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(CSc3nnc(-c4ccco4)o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H15N3O6S/c1-2-25-18(24)20-12-5-6-13-11(8-16(23)27-15(13)9-12)10-29-19-22-21-17(28-19)14-4-3-7-26-14/h3-9H,2,10H2,1H3,(H,20,24) |
| InChIKey | UEGSQWSHZVTCKQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|