C20H22NO4+ — CID 9256508
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-[(2-methoxyphenyl)methyl]azanium (PubChem CID 9256508) has the molecular formula C20H22NO4+ and a molecular weight of 340.40 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-[(2-methoxyphenyl)methyl]azanium.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-[(2-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9256508 |
| Molecular Formula | C20H22NO4+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl-[(2-methoxyphenyl)methyl]azanium |
| SMILES | CCc1cc2c(C[NH2+]Cc3ccccc3OC)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H21NO4/c1-3-13-8-16-15(9-20(23)25-19(16)10-17(13)22)12-21-11-14-6-4-5-7-18(14)24-2/h4-10,21-22H,3,11-12H2,1-2H3/p+1 |
| InChIKey | UFMKWQHAAOIPQO-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|