C20H22NO3+ — CID 7590165
(6,7-dimethyl-2-oxochromen-4-yl)methyl-[(3-methoxyphenyl)methyl]azanium (PubChem CID 7590165) has the molecular formula C20H22NO3+ and a molecular weight of 324.40 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(3-methoxyphenyl)methyl]azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(3-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7590165 |
| Molecular Formula | C20H22NO3+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(3-methoxyphenyl)methyl]azanium |
| SMILES | COc1cccc(C[NH2+]Cc2cc(=O)oc3cc(C)c(C)cc23)c1 |
| InChI | InChI=1S/C20H21NO3/c1-13-7-18-16(10-20(22)24-19(18)8-14(13)2)12-21-11-15-5-4-6-17(9-15)23-3/h4-10,21H,11-12H2,1-3H3/p+1 |
| InChIKey | MVTAMOZITDNBJM-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|