C18H15ClO3 — CID 7858868
4-[(3-chlorophenoxy)methyl]-6,7-dimethylchromen-2-one (PubChem CID 7858868) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 4-[(3-chlorophenoxy)methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[(3-chlorophenoxy)methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 7858868 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-[(3-chlorophenoxy)methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(COc3cccc(Cl)c3)c2cc1C |
| InChI | InChI=1S/C18H15ClO3/c1-11-6-16-13(8-18(20)22-17(16)7-12(11)2)10-21-15-5-3-4-14(19)9-15/h3-9H,10H2,1-2H3 |
| InChIKey | WFPIEEJGBQHSGK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|