C20H20ClNO2 — CID 9251054
4-[[(3-chlorophenyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 9251054) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 4-[[(3-chlorophenyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[(3-chlorophenyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9251054 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[[(3-chlorophenyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(C)Cc3cccc(Cl)c3)c2cc1C |
| InChI | InChI=1S/C20H20ClNO2/c1-13-7-18-16(10-20(23)24-19(18)8-14(13)2)12-22(3)11-15-5-4-6-17(21)9-15/h4-10H,11-12H2,1-3H3 |
| InChIKey | SCFPLFJSVOQFKG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|