C22H24ClNO4 — CID 46801636
6-chloro-4-[[(2,3-dimethoxyphenyl)methyl-methylamino]methyl]-7-ethylchromen-2-one (PubChem CID 46801636) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 6-chloro-4-[[(2,3-dimethoxyphenyl)methyl-methylamino]methyl]-7-ethylchromen-2-one.
| Compound Name | 6-chloro-4-[[(2,3-dimethoxyphenyl)methyl-methylamino]methyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 46801636 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 6-chloro-4-[[(2,3-dimethoxyphenyl)methyl-methylamino]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1cc2oc(=O)cc(CN(C)Cc3cccc(OC)c3OC)c2cc1Cl |
| InChI | InChI=1S/C22H24ClNO4/c1-5-14-9-20-17(11-18(14)23)16(10-21(25)28-20)13-24(2)12-15-7-6-8-19(26-3)22(15)27-4/h6-11H,5,12-13H2,1-4H3 |
| InChIKey | DARMURUCGFGTGW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|